C15H20BrN3OS — CID 80632198
N-[(4-bromothiophen-2-yl)methyl]-5-[(2-methoxyethylamino)methyl]-N-methylpyridin-2-amine (PubChem CID 80632198) has the molecular formula C15H20BrN3OS and a molecular weight of 370.32 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-5-[(2-methoxyethylamino)methyl]-N-methylpyridin-2-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-5-[(2-methoxyethylamino)methyl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 80632198 |
| Molecular Formula | C15H20BrN3OS |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-5-[(2-methoxyethylamino)methyl]-N-methylpyridin-2-amine |
| SMILES | COCCNCc1ccc(N(C)Cc2cc(Br)cs2)nc1 |
| InChI | InChI=1S/C15H20BrN3OS/c1-19(10-14-7-13(16)11-21-14)15-4-3-12(9-18-15)8-17-5-6-20-2/h3-4,7,9,11,17H,5-6,8,10H2,1-2H3 |
| InChIKey | WWKTZDGKTUCBGP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|