C54H100N2O10 — CID 178143714
bis[6-(2-hexyldecanoyloxy)hexyl] (2S)-2-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]pentanedioate (PubChem CID 178143714) has the molecular formula C54H100N2O10 and a molecular weight of 937.40 g/mol. Its IUPAC name is bis[6-(2-hexyldecanoyloxy)hexyl] (2S)-2-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]pentanedioate.
| Compound Name | bis[6-(2-hexyldecanoyloxy)hexyl] (2S)-2-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 178143714 |
| Molecular Formula | C54H100N2O10 |
| Molecular Weight | 937.40 g/mol |
| Exact Mass | 936.74 |
| IUPAC Name | bis[6-(2-hexyldecanoyloxy)hexyl] (2S)-2-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]pentanedioate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCOC(=O)CC[C@H](NC(=O)[C@@H]1C[C@@H](O)CN1)C(=O)OCCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C54H100N2O10/c1-5-9-13-17-19-27-35-45(33-25-15-11-7-3)52(60)64-40-30-22-21-29-39-63-50(58)38-37-48(56-51(59)49-43-47(57)44-55-49)54(62)66-42-32-24-23-31-41-65-53(61)46(34-26-16-12-8-4)36-28-20-18-14-10-6-2/h45-49,55,57H,5-44H2,1-4H3,(H,56,59)/t45?,46?,47-,48+,49+/m1/s1 |
| InChIKey | HNOLZBQUGOSCHO-OYXUFCRKSA-N |
| XLogP | 11.94 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.40 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|