C19H21NO5 — CID 178145287
cyclopropylmethyl 7-methyl-3,4-dioxospiro[chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 178145287) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is cyclopropylmethyl 7-methyl-3,4-dioxospiro[chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | cyclopropylmethyl 7-methyl-3,4-dioxospiro[chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 178145287 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | cyclopropylmethyl 7-methyl-3,4-dioxospiro[chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | Cc1ccc2c(c1)OC1(CCN(C(=O)OCC3CC3)CC1)C(=O)C2=O |
| InChI | InChI=1S/C19H21NO5/c1-12-2-5-14-15(10-12)25-19(17(22)16(14)21)6-8-20(9-7-19)18(23)24-11-13-3-4-13/h2,5,10,13H,3-4,6-9,11H2,1H3 |
| InChIKey | YOKCOBDGUONEIW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|