C18H25N7O2 — CID 178146886
1-[(3R)-1-(4-amino-2-pyridinyl)piperidin-3-yl]-3-(5-ethoxypyrazin-2-yl)-1-methylurea (PubChem CID 178146886) has the molecular formula C18H25N7O2 and a molecular weight of 371.45 g/mol. Its IUPAC name is 1-[(3R)-1-(4-amino-2-pyridinyl)piperidin-3-yl]-3-(5-ethoxypyrazin-2-yl)-1-methylurea.
| Compound Name | 1-[(3R)-1-(4-amino-2-pyridinyl)piperidin-3-yl]-3-(5-ethoxypyrazin-2-yl)-1-methylurea |
|---|---|
| PubChem CID | 178146886 |
| Molecular Formula | C18H25N7O2 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 1-[(3R)-1-(4-amino-2-pyridinyl)piperidin-3-yl]-3-(5-ethoxypyrazin-2-yl)-1-methylurea |
| SMILES | CCOc1cnc(NC(=O)N(C)[C@@H]2CCCN(c3cc(N)ccn3)C2)cn1 |
| InChI | InChI=1S/C18H25N7O2/c1-3-27-17-11-21-15(10-22-17)23-18(26)24(2)14-5-4-8-25(12-14)16-9-13(19)6-7-20-16/h6-7,9-11,14H,3-5,8,12H2,1-2H3,(H2,19,20)(H,21,23,26)/t14-/m1/s1 |
| InChIKey | QZLMRBAVLAPMSD-CQSZACIVSA-N |
| XLogP | 1.99 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |