C13H21N5O2 — CID 178146937
3-(5-ethoxypyrazin-2-yl)-1-methyl-1-[(3R)-piperidin-3-yl]urea (PubChem CID 178146937) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-(5-ethoxypyrazin-2-yl)-1-methyl-1-[(3R)-piperidin-3-yl]urea.
| Compound Name | 3-(5-ethoxypyrazin-2-yl)-1-methyl-1-[(3R)-piperidin-3-yl]urea |
|---|---|
| PubChem CID | 178146937 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 3-(5-ethoxypyrazin-2-yl)-1-methyl-1-[(3R)-piperidin-3-yl]urea |
| SMILES | CCOc1cnc(NC(=O)N(C)[C@@H]2CCCNC2)cn1 |
| InChI | InChI=1S/C13H21N5O2/c1-3-20-12-9-15-11(8-16-12)17-13(19)18(2)10-5-4-6-14-7-10/h8-10,14H,3-7H2,1-2H3,(H,15,17,19)/t10-/m1/s1 |
| InChIKey | RWAVWJPNRUSURC-SNVBAGLBSA-N |
| XLogP | 1.09 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |