C8H17NO — CID 178147098
(2R,4R)-2-ethyl-4-(methoxymethyl)pyrrolidine (PubChem CID 178147098) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is (2R,4R)-2-ethyl-4-(methoxymethyl)pyrrolidine.
| Compound Name | (2R,4R)-2-ethyl-4-(methoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 178147098 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (2R,4R)-2-ethyl-4-(methoxymethyl)pyrrolidine |
| SMILES | CC[C@@H]1C[C@@H](COC)CN1 |
| InChI | InChI=1S/C8H17NO/c1-3-8-4-7(5-9-8)6-10-2/h7-9H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | BIRPQGNIIJFWQH-HTQZYQBOSA-N |
| XLogP | 1.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |