C8H18N2 — CID 124676173
2-[(2S,4R)-4-ethylpyrrolidin-2-yl]ethanamine (PubChem CID 124676173) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 2-[(2S,4R)-4-ethylpyrrolidin-2-yl]ethanamine.
| Compound Name | 2-[(2S,4R)-4-ethylpyrrolidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 124676173 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 2-[(2S,4R)-4-ethylpyrrolidin-2-yl]ethanamine |
| SMILES | CC[C@H]1CN[C@H](CCN)C1 |
| InChI | InChI=1S/C8H18N2/c1-2-7-5-8(3-4-9)10-6-7/h7-8,10H,2-6,9H2,1H3/t7-,8-/m1/s1 |
| InChIKey | XSNSDFMWDHFAQK-HTQZYQBOSA-N |
| XLogP | 0.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |