C9H21N3 — CID 131048640
2-[(2S,5S)-5-propan-2-ylpiperazin-2-yl]ethanamine (PubChem CID 131048640) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is 2-[(2S,5S)-5-propan-2-ylpiperazin-2-yl]ethanamine.
| Compound Name | 2-[(2S,5S)-5-propan-2-ylpiperazin-2-yl]ethanamine |
|---|---|
| PubChem CID | 131048640 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 2-[(2S,5S)-5-propan-2-ylpiperazin-2-yl]ethanamine |
| SMILES | CC(C)[C@H]1CN[C@@H](CCN)CN1 |
| InChI | InChI=1S/C9H21N3/c1-7(2)9-6-11-8(3-4-10)5-12-9/h7-9,11-12H,3-6,10H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | VLOBAYDNSZGYEU-DTWKUNHWSA-N |
| XLogP | -0.08 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |