About 4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine
4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine (PubChem CID 155003920) has the molecular formula C11H23N3OS
and a molecular weight of 245.39 g/mol. Its IUPAC name is 4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine.
Molecular Properties
| Compound Name | 4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine |
| PubChem CID | 155003920 |
| Molecular Formula | C11H23N3OS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine |
| SMILES | CC(C)C1CNC(OCC2CSCN2)CN1 |
| InChI | InChI=1S/C11H23N3OS/c1-8(2)10-3-13-11(4-12-10)15-5-9-6-16-7-14-9/h8-14H,3-7H2,1-2H3 |
| InChIKey | DHIFGTFVDAMPJE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine?
The IUPAC name of 4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine (CID 155003920) is 4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine.
What is the SMILES notation for 4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine?
The canonical SMILES for 4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine is CC(C)C1CNC(OCC2CSCN2)CN1.
What is the InChIKey of 4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine?
The InChIKey is DHIFGTFVDAMPJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3OS/c1-8(2)10-3-13-11(4-12-10)15-5-9-6-16-7-14-9/h8-14H,3-7H2,1-2H3.
What are the key properties of 4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine?
4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine has a molecular weight of 245.39 g/mol, XLogP of 0.21, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-propan-2-ylpiperazin-2-yl)oxymethyl]-1,3-thiazolidine is sourced from PubChem (CID 155003920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).