About 4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine
4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine (PubChem CID 43199796) has the molecular formula C11H22N2S
and a molecular weight of 214.38 g/mol. Its IUPAC name is 4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine.
Molecular Properties
| Compound Name | 4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine |
| PubChem CID | 43199796 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine |
| SMILES | CC1CCCC(C)N1CC1CSCN1 |
| InChI | InChI=1S/C11H22N2S/c1-9-4-3-5-10(2)13(9)6-11-7-14-8-12-11/h9-12H,3-8H2,1-2H3 |
| InChIKey | RHDVZMQMZFHYFM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine?
The IUPAC name of 4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine (CID 43199796) is 4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine.
What is the SMILES notation for 4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine?
The canonical SMILES for 4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine is CC1CCCC(C)N1CC1CSCN1.
What is the InChIKey of 4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine?
The InChIKey is RHDVZMQMZFHYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2S/c1-9-4-3-5-10(2)13(9)6-11-7-14-8-12-11/h9-12H,3-8H2,1-2H3.
What are the key properties of 4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine?
4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine has a molecular weight of 214.38 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dimethylpiperidin-1-yl)methyl]-1,3-thiazolidine is sourced from PubChem (CID 43199796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).