C10H20N2OS — CID 43592953
2,2-dimethyl-4-(1,3-thiazolidin-4-ylmethyl)morpholine (PubChem CID 43592953) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is 2,2-dimethyl-4-(1,3-thiazolidin-4-ylmethyl)morpholine.
| Compound Name | 2,2-dimethyl-4-(1,3-thiazolidin-4-ylmethyl)morpholine |
|---|---|
| PubChem CID | 43592953 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2,2-dimethyl-4-(1,3-thiazolidin-4-ylmethyl)morpholine |
| SMILES | CC1(C)CN(CC2CSCN2)CCO1 |
| InChI | InChI=1S/C10H20N2OS/c1-10(2)7-12(3-4-13-10)5-9-6-14-8-11-9/h9,11H,3-8H2,1-2H3 |
| InChIKey | XQUAWUUBCPYJBQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |