C10H21N3S — CID 43199782
4-[(4-ethylpiperazin-1-yl)methyl]-1,3-thiazolidine (PubChem CID 43199782) has the molecular formula C10H21N3S and a molecular weight of 215.37 g/mol. Its IUPAC name is 4-[(4-ethylpiperazin-1-yl)methyl]-1,3-thiazolidine.
| Compound Name | 4-[(4-ethylpiperazin-1-yl)methyl]-1,3-thiazolidine |
|---|---|
| PubChem CID | 43199782 |
| Molecular Formula | C10H21N3S |
| Molecular Weight | 215.37 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 4-[(4-ethylpiperazin-1-yl)methyl]-1,3-thiazolidine |
| SMILES | CCN1CCN(CC2CSCN2)CC1 |
| InChI | InChI=1S/C10H21N3S/c1-2-12-3-5-13(6-4-12)7-10-8-14-9-11-10/h10-11H,2-9H2,1H3 |
| InChIKey | ZKFSHHURGNLCOR-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.37 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |