C19H29FLrN3O2- — CID 178150116
tert-butyl (2R)-4-[2-amino-2-(3-fluoro-4-methylphenyl)ethyl]-2-methylpiperazin-3-ide-1-carboxylate;lawrencium (PubChem CID 178150116) has the molecular formula C19H29FLrN3O2- and a molecular weight of 612.46 g/mol. Its IUPAC name is tert-butyl (2R)-4-[2-amino-2-(3-fluoro-4-methylphenyl)ethyl]-2-methylpiperazin-3-ide-1-carboxylate;lawrencium.
| Compound Name | tert-butyl (2R)-4-[2-amino-2-(3-fluoro-4-methylphenyl)ethyl]-2-methylpiperazin-3-ide-1-carboxylate;lawrencium |
|---|---|
| PubChem CID | 178150116 |
| Molecular Formula | C19H29FLrN3O2- |
| Molecular Weight | 612.46 g/mol |
| Exact Mass | 612.33 |
| IUPAC Name | tert-butyl (2R)-4-[2-amino-2-(3-fluoro-4-methylphenyl)ethyl]-2-methylpiperazin-3-ide-1-carboxylate;lawrencium |
| SMILES | Cc1ccc(C(N)CN2[CH-][C@@H](C)N(C(=O)OC(C)(C)C)CC2)cc1F.[Lr] |
| InChI | InChI=1S/C19H29FN3O2.Lr/c1-13-6-7-15(10-16(13)20)17(21)12-22-8-9-23(14(2)11-22)18(24)25-19(3,4)5;/h6-7,10-11,14,17H,8-9,12,21H2,1-5H3;/q-1;/t14-,17?;/m1./s1 |
| InChIKey | KYVYMUGJVXZUSL-JOZUQTIUSA-N |
| XLogP | 3.24 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|