C29H31FLrN3O4S- — CID 178149752
4-[(1S)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-2-id-1-yl]ethoxy]-N-phenylbenzenesulfonamide;lawrencium (PubChem CID 178149752) has the molecular formula C29H31FLrN3O4S- and a molecular weight of 798.65 g/mol. Its IUPAC name is 4-[(1S)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-2-id-1-yl]ethoxy]-N-phenylbenzenesulfonamide;lawrencium.
| Compound Name | 4-[(1S)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-2-id-1-yl]ethoxy]-N-phenylbenzenesulfonamide;lawrencium |
|---|---|
| PubChem CID | 178149752 |
| Molecular Formula | C29H31FLrN3O4S- |
| Molecular Weight | 798.65 g/mol |
| Exact Mass | 798.31 |
| IUPAC Name | 4-[(1S)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-2-id-1-yl]ethoxy]-N-phenylbenzenesulfonamide;lawrencium |
| SMILES | C=CC(=O)N1CCN(C[C@@H](Oc2ccc(S(=O)(=O)Nc3ccccc3)cc2)c2ccc(C)c(F)c2)[CH-][C@H]1C.[Lr] |
| InChI | InChI=1S/C29H31FN3O4S.Lr/c1-4-29(34)33-17-16-32(19-22(33)3)20-28(23-11-10-21(2)27(30)18-23)37-25-12-14-26(15-13-25)38(35,36)31-24-8-6-5-7-9-24;/h4-15,18-19,22,28,31H,1,16-17,20H2,2-3H3;/q-1;/t22-,28-;/m1./s1 |
| InChIKey | XFKSOJOKPWFEJI-LNHWOQJCSA-N |
| XLogP | 4.94 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.65 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|