C25H29FN2O4 — CID 178149249
4-[(1R)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]-2-methylbenzoic acid (PubChem CID 178149249) has the molecular formula C25H29FN2O4 and a molecular weight of 440.52 g/mol. Its IUPAC name is 4-[(1R)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]-2-methylbenzoic acid.
| Compound Name | 4-[(1R)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 178149249 |
| Molecular Formula | C25H29FN2O4 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 4-[(1R)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]-2-methylbenzoic acid |
| SMILES | C=CC(=O)N1CCN(C[C@H](Oc2ccc(C(=O)O)c(C)c2)c2ccc(C)c(F)c2)C[C@H]1C |
| InChI | InChI=1S/C25H29FN2O4/c1-5-24(29)28-11-10-27(14-18(28)4)15-23(19-7-6-16(2)22(26)13-19)32-20-8-9-21(25(30)31)17(3)12-20/h5-9,12-13,18,23H,1,10-11,14-15H2,2-4H3,(H,30,31)/t18-,23+/m1/s1 |
| InChIKey | UMGFPGDDVVJQSJ-JPYJTQIMSA-N |
| XLogP | 3.98 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|