C26H33FN4O2 — CID 178149602
4-[[(1S)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethyl]amino]-N,2-dimethylbenzamide (PubChem CID 178149602) has the molecular formula C26H33FN4O2 and a molecular weight of 452.57 g/mol. Its IUPAC name is 4-[[(1S)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethyl]amino]-N,2-dimethylbenzamide.
| Compound Name | 4-[[(1S)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethyl]amino]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 178149602 |
| Molecular Formula | C26H33FN4O2 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 4-[[(1S)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethyl]amino]-N,2-dimethylbenzamide |
| SMILES | C=CC(=O)N1CCN(C[C@@H](Nc2ccc(C(=O)NC)c(C)c2)c2ccc(C)c(F)c2)C[C@H]1C |
| InChI | InChI=1S/C26H33FN4O2/c1-6-25(32)31-12-11-30(15-19(31)4)16-24(20-8-7-17(2)23(27)14-20)29-21-9-10-22(18(3)13-21)26(33)28-5/h6-10,13-14,19,24,29H,1,11-12,15-16H2,2-5H3,(H,28,33)/t19-,24-/m1/s1 |
| InChIKey | XLNJAEAPDOVCDA-NTKDMRAZSA-N |
| XLogP | 3.67 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|