C24H28FN3O3 — CID 178149516
4-[1-(3-fluorophenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]-N-methylbenzamide (PubChem CID 178149516) has the molecular formula C24H28FN3O3 and a molecular weight of 425.50 g/mol. Its IUPAC name is 4-[1-(3-fluorophenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]-N-methylbenzamide.
| Compound Name | 4-[1-(3-fluorophenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]-N-methylbenzamide |
|---|---|
| PubChem CID | 178149516 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-[1-(3-fluorophenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]-N-methylbenzamide |
| SMILES | C=CC(=O)N1CCN(CC(Oc2ccc(C(=O)NC)cc2)c2cccc(F)c2)C[C@H]1C |
| InChI | InChI=1S/C24H28FN3O3/c1-4-23(29)28-13-12-27(15-17(28)2)16-22(19-6-5-7-20(25)14-19)31-21-10-8-18(9-11-21)24(30)26-3/h4-11,14,17,22H,1,12-13,15-16H2,2-3H3,(H,26,30)/t17-,22?/m1/s1 |
| InChIKey | DHDRXZOQMCRHEZ-PLEWWHCXSA-N |
| XLogP | 3.02 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|