C30H38FN3O3 — CID 178151284
N-(2-cyclobutylethyl)-4-[(1S)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]benzamide (PubChem CID 178151284) has the molecular formula C30H38FN3O3 and a molecular weight of 507.65 g/mol. Its IUPAC name is N-(2-cyclobutylethyl)-4-[(1S)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]benzamide.
| Compound Name | N-(2-cyclobutylethyl)-4-[(1S)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]benzamide |
|---|---|
| PubChem CID | 178151284 |
| Molecular Formula | C30H38FN3O3 |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | N-(2-cyclobutylethyl)-4-[(1S)-1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]benzamide |
| SMILES | C=CC(=O)N1CCN(C[C@@H](Oc2ccc(C(=O)NCCC3CCC3)cc2)c2ccc(C)c(F)c2)C[C@H]1C |
| InChI | InChI=1S/C30H38FN3O3/c1-4-29(35)34-17-16-33(19-22(34)3)20-28(25-9-8-21(2)27(31)18-25)37-26-12-10-24(11-13-26)30(36)32-15-14-23-6-5-7-23/h4,8-13,18,22-23,28H,1,5-7,14-17,19-20H2,2-3H3,(H,32,36)/t22-,28-/m1/s1 |
| InChIKey | UEFCRMRSZUIITL-SKCUWOTOSA-N |
| XLogP | 4.89 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|