C24H27FN2O4 — CID 178149311
4-[1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]benzoic acid (PubChem CID 178149311) has the molecular formula C24H27FN2O4 and a molecular weight of 426.49 g/mol. Its IUPAC name is 4-[1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]benzoic acid.
| Compound Name | 4-[1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 178149311 |
| Molecular Formula | C24H27FN2O4 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 4-[1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]benzoic acid |
| SMILES | C=CC(=O)N1CCN(CC(Oc2ccc(C(=O)O)cc2)c2ccc(C)c(F)c2)C[C@H]1C |
| InChI | InChI=1S/C24H27FN2O4/c1-4-23(28)27-12-11-26(14-17(27)3)15-22(19-6-5-16(2)21(25)13-19)31-20-9-7-18(8-10-20)24(29)30/h4-10,13,17,22H,1,11-12,14-15H2,2-3H3,(H,29,30)/t17-,22?/m1/s1 |
| InChIKey | NZRFSZMBMCGHKH-PLEWWHCXSA-N |
| XLogP | 3.67 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|