C26H31FN2O4 — CID 178150296
2-ethyl-4-[1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]benzoic acid (PubChem CID 178150296) has the molecular formula C26H31FN2O4 and a molecular weight of 454.54 g/mol. Its IUPAC name is 2-ethyl-4-[1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]benzoic acid.
| Compound Name | 2-ethyl-4-[1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 178150296 |
| Molecular Formula | C26H31FN2O4 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-ethyl-4-[1-(3-fluoro-4-methylphenyl)-2-[(3R)-3-methyl-4-prop-2-enoylpiperazin-1-yl]ethoxy]benzoic acid |
| SMILES | C=CC(=O)N1CCN(CC(Oc2ccc(C(=O)O)c(CC)c2)c2ccc(C)c(F)c2)C[C@H]1C |
| InChI | InChI=1S/C26H31FN2O4/c1-5-19-13-21(9-10-22(19)26(31)32)33-24(20-8-7-17(3)23(27)14-20)16-28-11-12-29(18(4)15-28)25(30)6-2/h6-10,13-14,18,24H,2,5,11-12,15-16H2,1,3-4H3,(H,31,32)/t18-,24?/m1/s1 |
| InChIKey | IWKBMDMESURFJY-QFADGXAASA-N |
| XLogP | 4.23 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|