About N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane
N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane (PubChem CID 178150429) has the molecular formula C17H23N3O2
and a molecular weight of 301.39 g/mol. Its IUPAC name is N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane.
Molecular Properties
| Compound Name | N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane |
| PubChem CID | 178150429 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane |
| SMILES | CC.COc1cnc(C(=O)Nc2ncc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C15H17N3O2.C2H6/c1-9-5-11(3)14(17-7-9)18-15(19)13-10(2)6-12(20-4)8-16-13;1-2/h5-8H,1-4H3,(H,17,18,19);1-2H3 |
| InChIKey | DTEIDROKYUMNDP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane?
The IUPAC name of N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane (CID 178150429) is N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane.
What is the SMILES notation for N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane?
The canonical SMILES for N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane is CC.COc1cnc(C(=O)Nc2ncc(C)cc2C)c(C)c1.
What is the InChIKey of N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane?
The InChIKey is DTEIDROKYUMNDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2.C2H6/c1-9-5-11(3)14(17-7-9)18-15(19)13-10(2)6-12(20-4)8-16-13;1-2/h5-8H,1-4H3,(H,17,18,19);1-2H3.
What are the key properties of N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane?
N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane has a molecular weight of 301.39 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethyl-2-pyridinyl)-5-methoxy-3-methylpyridine-2-carboxamide;ethane is sourced from PubChem (CID 178150429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).