C8H6FN5 — CID 178151738
4-(4-fluoro-3-pyridinyl)-1,3,5-triazin-2-amine (PubChem CID 178151738) has the molecular formula C8H6FN5 and a molecular weight of 191.17 g/mol. Its IUPAC name is 4-(4-fluoro-3-pyridinyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-fluoro-3-pyridinyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 178151738 |
| Molecular Formula | C8H6FN5 |
| Molecular Weight | 191.17 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 4-(4-fluoro-3-pyridinyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1ncnc(-c2cnccc2F)n1 |
| InChI | InChI=1S/C8H6FN5/c9-6-1-2-11-3-5(6)7-12-4-13-8(10)14-7/h1-4H,(H2,10,12,13,14) |
| InChIKey | NGPPLTOTGOSDCS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |