C21H23N5O6 — CID 178154746
(E)-N-(2,6-dioxopiperidin-3-yl)-3-[[3-[4-(hydroxymethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl-methylamino]-N-methyl-4-oxobut-2-enamide (PubChem CID 178154746) has the molecular formula C21H23N5O6 and a molecular weight of 441.44 g/mol. Its IUPAC name is (E)-N-(2,6-dioxopiperidin-3-yl)-3-[[3-[4-(hydroxymethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl-methylamino]-N-methyl-4-oxobut-2-enamide.
| Compound Name | (E)-N-(2,6-dioxopiperidin-3-yl)-3-[[3-[4-(hydroxymethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl-methylamino]-N-methyl-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 178154746 |
| Molecular Formula | C21H23N5O6 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (E)-N-(2,6-dioxopiperidin-3-yl)-3-[[3-[4-(hydroxymethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl-methylamino]-N-methyl-4-oxobut-2-enamide |
| SMILES | CN(Cc1nc(-c2ccc(CO)cc2)no1)/C(C=O)=C/C(=O)N(C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C21H23N5O6/c1-25(10-18-23-20(24-32-18)14-5-3-13(11-27)4-6-14)15(12-28)9-19(30)26(2)16-7-8-17(29)22-21(16)31/h3-6,9,12,16,27H,7-8,10-11H2,1-2H3,(H,22,29,31)/b15-9+ |
| InChIKey | UFRXHEDZDBVKDH-OQLLNIDSSA-N |
| XLogP | 0.01 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|