C28H26F2N6O5 — CID 178100896
1-[[3-[3-[2-(difluoromethyl)-3-pyridinyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]-N-(2,6-dioxopiperidin-3-yl)-6-formyl-N-methyl-3,4-dihydro-2H-pyridine-5-carboxamide (PubChem CID 178100896) has the molecular formula C28H26F2N6O5 and a molecular weight of 564.55 g/mol. Its IUPAC name is 1-[[3-[3-[2-(difluoromethyl)-3-pyridinyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]-N-(2,6-dioxopiperidin-3-yl)-6-formyl-N-methyl-3,4-dihydro-2H-pyridine-5-carboxamide.
| Compound Name | 1-[[3-[3-[2-(difluoromethyl)-3-pyridinyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]-N-(2,6-dioxopiperidin-3-yl)-6-formyl-N-methyl-3,4-dihydro-2H-pyridine-5-carboxamide |
|---|---|
| PubChem CID | 178100896 |
| Molecular Formula | C28H26F2N6O5 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 1-[[3-[3-[2-(difluoromethyl)-3-pyridinyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]-N-(2,6-dioxopiperidin-3-yl)-6-formyl-N-methyl-3,4-dihydro-2H-pyridine-5-carboxamide |
| SMILES | CN(C(=O)C1=C(C=O)N(Cc2nc(-c3cccc(-c4cccnc4C(F)F)c3)no2)CCC1)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C28H26F2N6O5/c1-35(20-9-10-22(38)32-27(20)39)28(40)19-8-4-12-36(21(19)15-37)14-23-33-26(34-41-23)17-6-2-5-16(13-17)18-7-3-11-31-24(18)25(29)30/h2-3,5-7,11,13,15,20,25H,4,8-10,12,14H2,1H3,(H,32,38,39) |
| InChIKey | GHKNJUHLUNOPCW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|