C18H13N5 — CID 178156419
9-pyridin-3-yl-11-pyridin-4-yl-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene (PubChem CID 178156419) has the molecular formula C18H13N5 and a molecular weight of 299.34 g/mol. Its IUPAC name is 9-pyridin-3-yl-11-pyridin-4-yl-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene.
| Compound Name | 9-pyridin-3-yl-11-pyridin-4-yl-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene |
|---|---|
| PubChem CID | 178156419 |
| Molecular Formula | C18H13N5 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 9-pyridin-3-yl-11-pyridin-4-yl-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene |
| SMILES | C1=CCC=NN2C=1N=C(c1cccnc1)C=C2c1ccncc1 |
| InChI | InChI=1S/C18H13N5/c1-2-9-21-23-17(14-6-10-19-11-7-14)12-16(22-18(23)5-1)15-4-3-8-20-13-15/h1,3-4,6-13H,2H2 |
| InChIKey | XOVXTQDXVUEDQL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |