C20H19FN4O2 — CID 178156569
tert-butyl N-[4-(6-fluoro-3-pyridinyl)-6-pyridin-4-yl-2-pyridinyl]carbamate (PubChem CID 178156569) has the molecular formula C20H19FN4O2 and a molecular weight of 366.40 g/mol. Its IUPAC name is tert-butyl N-[4-(6-fluoro-3-pyridinyl)-6-pyridin-4-yl-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-(6-fluoro-3-pyridinyl)-6-pyridin-4-yl-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 178156569 |
| Molecular Formula | C20H19FN4O2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | tert-butyl N-[4-(6-fluoro-3-pyridinyl)-6-pyridin-4-yl-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(-c2ccc(F)nc2)cc(-c2ccncc2)n1 |
| InChI | InChI=1S/C20H19FN4O2/c1-20(2,3)27-19(26)25-18-11-15(14-4-5-17(21)23-12-14)10-16(24-18)13-6-8-22-9-7-13/h4-12H,1-3H3,(H,24,25,26) |
| InChIKey | DQYYBJXUJJGNIJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|