C13H15N3O2S — CID 130690764
tert-butyl N-(2-pyridin-4-yl-1,3-thiazol-5-yl)carbamate (PubChem CID 130690764) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is tert-butyl N-(2-pyridin-4-yl-1,3-thiazol-5-yl)carbamate.
| Compound Name | tert-butyl N-(2-pyridin-4-yl-1,3-thiazol-5-yl)carbamate |
|---|---|
| PubChem CID | 130690764 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | tert-butyl N-(2-pyridin-4-yl-1,3-thiazol-5-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnc(-c2ccncc2)s1 |
| InChI | InChI=1S/C13H15N3O2S/c1-13(2,3)18-12(17)16-10-8-15-11(19-10)9-4-6-14-7-5-9/h4-8H,1-3H3,(H,16,17) |
| InChIKey | VOAPYCGRIHBCLC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |