C9H12ClNO2S — CID 11601095
tert-butyl N-(5-chlorothiophen-2-yl)carbamate (PubChem CID 11601095) has the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. Its IUPAC name is tert-butyl N-(5-chlorothiophen-2-yl)carbamate.
| Compound Name | tert-butyl N-(5-chlorothiophen-2-yl)carbamate |
|---|---|
| PubChem CID | 11601095 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | tert-butyl N-(5-chlorothiophen-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cl)s1 |
| InChI | InChI=1S/C9H12ClNO2S/c1-9(2,3)13-8(12)11-7-5-4-6(10)14-7/h4-5H,1-3H3,(H,11,12) |
| InChIKey | SLZLJXFJTIAWMB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |