C13H17N3O2S — CID 131057383
tert-butyl N-[5-(1-methylimidazol-2-yl)thiophen-2-yl]carbamate (PubChem CID 131057383) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is tert-butyl N-[5-(1-methylimidazol-2-yl)thiophen-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-(1-methylimidazol-2-yl)thiophen-2-yl]carbamate |
|---|---|
| PubChem CID | 131057383 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | tert-butyl N-[5-(1-methylimidazol-2-yl)thiophen-2-yl]carbamate |
| SMILES | Cn1ccnc1-c1ccc(NC(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C13H17N3O2S/c1-13(2,3)18-12(17)15-10-6-5-9(19-10)11-14-7-8-16(11)4/h5-8H,1-4H3,(H,15,17) |
| InChIKey | YGUAUMSLYDWXNZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |