C15H19N3O2S — CID 123401644
tert-butyl N-(5-ethyl-2-pyridin-4-yl-1,3-thiazol-4-yl)carbamate (PubChem CID 123401644) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is tert-butyl N-(5-ethyl-2-pyridin-4-yl-1,3-thiazol-4-yl)carbamate.
| Compound Name | tert-butyl N-(5-ethyl-2-pyridin-4-yl-1,3-thiazol-4-yl)carbamate |
|---|---|
| PubChem CID | 123401644 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | tert-butyl N-(5-ethyl-2-pyridin-4-yl-1,3-thiazol-4-yl)carbamate |
| SMILES | CCc1sc(-c2ccncc2)nc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H19N3O2S/c1-5-11-12(18-14(19)20-15(2,3)4)17-13(21-11)10-6-8-16-9-7-10/h6-9H,5H2,1-4H3,(H,18,19) |
| InChIKey | GRBROROSXFERQC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |