C13H11LiN2O2 — CID 178157804
lithium 3-[(4-methyl-2-pyridinyl)amino]benzoate (PubChem CID 178157804) has the molecular formula C13H11LiN2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is lithium 3-[(4-methyl-2-pyridinyl)amino]benzoate.
| Compound Name | lithium 3-[(4-methyl-2-pyridinyl)amino]benzoate |
|---|---|
| PubChem CID | 178157804 |
| Molecular Formula | C13H11LiN2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | lithium 3-[(4-methyl-2-pyridinyl)amino]benzoate |
| SMILES | Cc1ccnc(Nc2cccc(C(=O)[O-])c2)c1.[Li+] |
| InChI | InChI=1S/C13H12N2O2.Li/c1-9-5-6-14-12(7-9)15-11-4-2-3-10(8-11)13(16)17;/h2-8H,1H3,(H,14,15)(H,16,17);/q;+1/p-1 |
| InChIKey | GHAYIZFEYPIPJR-UHFFFAOYSA-M |
| XLogP | -1.50 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |