C13H24N2O — CID 178160170
(3R)-3-(2-imino-3-methylbut-3-enyl)piperidin-2-one;propane (PubChem CID 178160170) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is (3R)-3-(2-imino-3-methylbut-3-enyl)piperidin-2-one;propane.
| Compound Name | (3R)-3-(2-imino-3-methylbut-3-enyl)piperidin-2-one;propane |
|---|---|
| PubChem CID | 178160170 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (3R)-3-(2-imino-3-methylbut-3-enyl)piperidin-2-one;propane |
| SMILES | CCC.[H]/N=C(/C[C@H]1CCCNC1=O)C(=C)C |
| InChI | InChI=1S/C10H16N2O.C3H8/c1-7(2)9(11)6-8-4-3-5-12-10(8)13;1-3-2/h8,11H,1,3-6H2,2H3,(H,12,13);3H2,1-2H3/b11-9-;/t8-;/m1./s1 |
| InChIKey | PXPPNOKQGXIUMC-LAJCJTAPSA-N |
| XLogP | 2.91 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|