C22H14N4O2 — CID 178161983
(3S)-3-(4-azidophenyl)-7-ethynyl-3-(4-hydroxyphenyl)-1H-indol-2-one (PubChem CID 178161983) has the molecular formula C22H14N4O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is (3S)-3-(4-azidophenyl)-7-ethynyl-3-(4-hydroxyphenyl)-1H-indol-2-one.
| Compound Name | (3S)-3-(4-azidophenyl)-7-ethynyl-3-(4-hydroxyphenyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 178161983 |
| Molecular Formula | C22H14N4O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (3S)-3-(4-azidophenyl)-7-ethynyl-3-(4-hydroxyphenyl)-1H-indol-2-one |
| SMILES | C#Cc1cccc2c1NC(=O)[C@]2(c1ccc(O)cc1)c1ccc(N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C22H14N4O2/c1-2-14-4-3-5-19-20(14)24-21(28)22(19,16-8-12-18(27)13-9-16)15-6-10-17(11-7-15)25-26-23/h1,3-13,27H,(H,24,28)/t22-/m0/s1 |
| InChIKey | SZUAFTWESBGIMZ-QFIPXVFZSA-N |
| XLogP | 4.60 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|