C44H36N2O6 — CID 169008050
1-[4-[3,3-bis(4-hydroxyphenyl)-2-oxoindol-1-yl]butyl]-3,3-bis(4-hydroxyphenyl)indol-2-one (PubChem CID 169008050) has the molecular formula C44H36N2O6 and a molecular weight of 688.78 g/mol. Its IUPAC name is 1-[4-[3,3-bis(4-hydroxyphenyl)-2-oxoindol-1-yl]butyl]-3,3-bis(4-hydroxyphenyl)indol-2-one.
| Compound Name | 1-[4-[3,3-bis(4-hydroxyphenyl)-2-oxoindol-1-yl]butyl]-3,3-bis(4-hydroxyphenyl)indol-2-one |
|---|---|
| PubChem CID | 169008050 |
| Molecular Formula | C44H36N2O6 |
| Molecular Weight | 688.78 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | 1-[4-[3,3-bis(4-hydroxyphenyl)-2-oxoindol-1-yl]butyl]-3,3-bis(4-hydroxyphenyl)indol-2-one |
| SMILES | O=C1N(CCCCN2C(=O)C(c3ccc(O)cc3)(c3ccc(O)cc3)c3ccccc32)c2ccccc2C1(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C44H36N2O6/c47-33-19-11-29(12-20-33)43(30-13-21-34(48)22-14-30)37-7-1-3-9-39(37)45(41(43)51)27-5-6-28-46-40-10-4-2-8-38(40)44(42(46)52,31-15-23-35(49)24-16-31)32-17-25-36(50)26-18-32/h1-4,7-26,47-50H,5-6,27-28H2 |
| InChIKey | HZKDZUBOBASGES-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.78 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|