C16H17F4N3O4S — CID 178165361
5-[2-fluoro-6-hydroxy-4-[2-[(3E)-3-(2,2,2-trifluoroethylidene)pyrrolidin-1-yl]ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 178165361) has the molecular formula C16H17F4N3O4S and a molecular weight of 423.39 g/mol. Its IUPAC name is 5-[2-fluoro-6-hydroxy-4-[2-[(3E)-3-(2,2,2-trifluoroethylidene)pyrrolidin-1-yl]ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-fluoro-6-hydroxy-4-[2-[(3E)-3-(2,2,2-trifluoroethylidene)pyrrolidin-1-yl]ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 178165361 |
| Molecular Formula | C16H17F4N3O4S |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 5-[2-fluoro-6-hydroxy-4-[2-[(3E)-3-(2,2,2-trifluoroethylidene)pyrrolidin-1-yl]ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc(CCN3CC/C(=C\C(F)(F)F)C3)cc2F)S(=O)(=O)N1 |
| InChI | InChI=1S/C16H17F4N3O4S/c17-12-5-10(1-3-22-4-2-11(8-22)7-16(18,19)20)6-13(24)15(12)23-9-14(25)21-28(23,26)27/h5-7,24H,1-4,8-9H2,(H,21,25)/b11-7+ |
| InChIKey | ULRGGGZMDISYOQ-YRNVUSSQSA-N |
| XLogP | 1.45 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|