C17H19F4N3O4S — CID 178165384
5-[2-fluoro-6-methoxy-4-[2-[(3E)-3-(2,2,2-trifluoroethylidene)pyrrolidin-1-yl]ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 178165384) has the molecular formula C17H19F4N3O4S and a molecular weight of 437.42 g/mol. Its IUPAC name is 5-[2-fluoro-6-methoxy-4-[2-[(3E)-3-(2,2,2-trifluoroethylidene)pyrrolidin-1-yl]ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-fluoro-6-methoxy-4-[2-[(3E)-3-(2,2,2-trifluoroethylidene)pyrrolidin-1-yl]ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 178165384 |
| Molecular Formula | C17H19F4N3O4S |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 5-[2-fluoro-6-methoxy-4-[2-[(3E)-3-(2,2,2-trifluoroethylidene)pyrrolidin-1-yl]ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | COc1cc(CCN2CC/C(=C\C(F)(F)F)C2)cc(F)c1N1CC(=O)NS1(=O)=O |
| InChI | InChI=1S/C17H19F4N3O4S/c1-28-14-7-11(2-4-23-5-3-12(9-23)8-17(19,20)21)6-13(18)16(14)24-10-15(25)22-29(24,26)27/h6-8H,2-5,9-10H2,1H3,(H,22,25)/b12-8+ |
| InChIKey | FPOIMPFHPIEBHQ-XYOKQWHBSA-N |
| XLogP | 1.75 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|