C16H16FN3O8S2 — CID 166165203
N-[3-fluoro-5-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 166165203) has the molecular formula C16H16FN3O8S2 and a molecular weight of 461.45 g/mol. Its IUPAC name is N-[3-fluoro-5-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[3-fluoro-5-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 166165203 |
| Molecular Formula | C16H16FN3O8S2 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | N-[3-fluoro-5-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2)cc1OC |
| InChI | InChI=1S/C16H16FN3O8S2/c1-27-13-4-3-10(7-14(13)28-2)29(23,24)18-9-5-11(17)16(12(21)6-9)20-8-15(22)19-30(20,25)26/h3-7,18,21H,8H2,1-2H3,(H,19,22) |
| InChIKey | FEBFKGNCIXJUIE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |