C24H31N3O — CID 178165531
4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]-N-(2,4,4-trimethylhex-5-yn-2-yl)butanamide (PubChem CID 178165531) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]-N-(2,4,4-trimethylhex-5-yn-2-yl)butanamide.
| Compound Name | 4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]-N-(2,4,4-trimethylhex-5-yn-2-yl)butanamide |
|---|---|
| PubChem CID | 178165531 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]-N-(2,4,4-trimethylhex-5-yn-2-yl)butanamide |
| SMILES | C#CC(C)(C)CC(C)(C)NC(=O)CCCc1ccnc(-c2cc(C)ccn2)c1 |
| InChI | InChI=1S/C24H31N3O/c1-7-23(3,4)17-24(5,6)27-22(28)10-8-9-19-12-14-26-21(16-19)20-15-18(2)11-13-25-20/h1,11-16H,8-10,17H2,2-6H3,(H,27,28) |
| InChIKey | BGTNOUXRGLYZBP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|