C28H35N7O3 — CID 20704997
4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-3,3-dimethyl-N-[4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]butyl]butanamide (PubChem CID 20704997) has the molecular formula C28H35N7O3 and a molecular weight of 517.63 g/mol. Its IUPAC name is 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-3,3-dimethyl-N-[4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]butyl]butanamide.
| Compound Name | 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-3,3-dimethyl-N-[4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]butyl]butanamide |
|---|---|
| PubChem CID | 20704997 |
| Molecular Formula | C28H35N7O3 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-3,3-dimethyl-N-[4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]butyl]butanamide |
| SMILES | Cc1ccnc(-c2cc(CCCCNC(=O)CC(C)(C)Cc3nc4c([nH]3)c(=O)n(C)c(=O)n4C)ccn2)c1 |
| InChI | InChI=1S/C28H35N7O3/c1-18-9-12-29-20(14-18)21-15-19(10-13-30-21)8-6-7-11-31-23(36)17-28(2,3)16-22-32-24-25(33-22)34(4)27(38)35(5)26(24)37/h9-10,12-15H,6-8,11,16-17H2,1-5H3,(H,31,36)(H,32,33) |
| InChIKey | UKCJVMICOSBLPT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|