C33H67NO2 — CID 178167149
(9-ethyl-9-methylundecyl) 3-(dioctylamino)propanoate (PubChem CID 178167149) has the molecular formula C33H67NO2 and a molecular weight of 509.90 g/mol. Its IUPAC name is (9-ethyl-9-methylundecyl) 3-(dioctylamino)propanoate.
| Compound Name | (9-ethyl-9-methylundecyl) 3-(dioctylamino)propanoate |
|---|---|
| PubChem CID | 178167149 |
| Molecular Formula | C33H67NO2 |
| Molecular Weight | 509.90 g/mol |
| Exact Mass | 509.52 |
| IUPAC Name | (9-ethyl-9-methylundecyl) 3-(dioctylamino)propanoate |
| SMILES | CCCCCCCCN(CCCCCCCC)CCC(=O)OCCCCCCCCC(C)(CC)CC |
| InChI | InChI=1S/C33H67NO2/c1-6-10-12-14-19-23-28-34(29-24-20-15-13-11-7-2)30-26-32(35)36-31-25-21-17-16-18-22-27-33(5,8-3)9-4/h6-31H2,1-5H3 |
| InChIKey | CPNIRALIXYAELV-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.90 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|