C34H43N3O5 — CID 178167273
tert-butyl 5-methoxy-4-[[(1S,2R,4S,8R)-8-(4-methoxycarbonylphenyl)-3,3-dimethyl-6,9-diazatricyclo[4.4.0.02,4]decan-9-yl]methyl]-7-methylindole-1-carboxylate (PubChem CID 178167273) has the molecular formula C34H43N3O5 and a molecular weight of 573.73 g/mol. Its IUPAC name is tert-butyl 5-methoxy-4-[[(1S,2R,4S,8R)-8-(4-methoxycarbonylphenyl)-3,3-dimethyl-6,9-diazatricyclo[4.4.0.02,4]decan-9-yl]methyl]-7-methylindole-1-carboxylate.
| Compound Name | tert-butyl 5-methoxy-4-[[(1S,2R,4S,8R)-8-(4-methoxycarbonylphenyl)-3,3-dimethyl-6,9-diazatricyclo[4.4.0.02,4]decan-9-yl]methyl]-7-methylindole-1-carboxylate |
|---|---|
| PubChem CID | 178167273 |
| Molecular Formula | C34H43N3O5 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.32 |
| IUPAC Name | tert-butyl 5-methoxy-4-[[(1S,2R,4S,8R)-8-(4-methoxycarbonylphenyl)-3,3-dimethyl-6,9-diazatricyclo[4.4.0.02,4]decan-9-yl]methyl]-7-methylindole-1-carboxylate |
| SMILES | COC(=O)c1ccc([C@@H]2CN3C[C@H]4[C@@H]([C@H]3CN2Cc2c(OC)cc(C)c3c2ccn3C(=O)OC(C)(C)C)C4(C)C)cc1 |
| InChI | InChI=1S/C34H43N3O5/c1-20-15-28(40-7)24(23-13-14-37(30(20)23)32(39)42-33(2,3)4)16-35-19-27-29-25(34(29,5)6)17-36(27)18-26(35)21-9-11-22(12-10-21)31(38)41-8/h9-15,25-27,29H,16-19H2,1-8H3/t25-,26-,27+,29-/m0/s1 |
| InChIKey | MHHOYBPVKSVPBS-RZLMRTLUSA-N |
| XLogP | 6.04 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |