C9H13FO — CID 178167476
1-ethoxy-6-fluoro-5-methylcyclohexa-1,3-diene (PubChem CID 178167476) has the molecular formula C9H13FO and a molecular weight of 156.20 g/mol. Its IUPAC name is 1-ethoxy-6-fluoro-5-methylcyclohexa-1,3-diene.
| Compound Name | 1-ethoxy-6-fluoro-5-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 178167476 |
| Molecular Formula | C9H13FO |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 1-ethoxy-6-fluoro-5-methylcyclohexa-1,3-diene |
| SMILES | CCOC1=CC=CC(C)C1F |
| InChI | InChI=1S/C9H13FO/c1-3-11-8-6-4-5-7(2)9(8)10/h4-7,9H,3H2,1-2H3 |
| InChIKey | WHXZAWNNYQVOQY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |