C32H38F2N6O4 — CID 178168532
1-[2-[[6-[3,4-difluoro-2-[2-[3-(1-hydroxy-2,2-dimethylpropyl)-1,5-dimethylpyrazol-4-yl]ethoxy]phenyl]imidazo[1,2-a]pyridin-3-yl]methylamino]ethyl]pyrrolidine-2,5-dione (PubChem CID 178168532) has the molecular formula C32H38F2N6O4 and a molecular weight of 608.69 g/mol. Its IUPAC name is 1-[2-[[6-[3,4-difluoro-2-[2-[3-(1-hydroxy-2,2-dimethylpropyl)-1,5-dimethylpyrazol-4-yl]ethoxy]phenyl]imidazo[1,2-a]pyridin-3-yl]methylamino]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[[6-[3,4-difluoro-2-[2-[3-(1-hydroxy-2,2-dimethylpropyl)-1,5-dimethylpyrazol-4-yl]ethoxy]phenyl]imidazo[1,2-a]pyridin-3-yl]methylamino]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 178168532 |
| Molecular Formula | C32H38F2N6O4 |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | 1-[2-[[6-[3,4-difluoro-2-[2-[3-(1-hydroxy-2,2-dimethylpropyl)-1,5-dimethylpyrazol-4-yl]ethoxy]phenyl]imidazo[1,2-a]pyridin-3-yl]methylamino]ethyl]pyrrolidine-2,5-dione |
| SMILES | Cc1c(CCOc2c(-c3ccc4ncc(CNCCN5C(=O)CCC5=O)n4c3)ccc(F)c2F)c(C(O)C(C)(C)C)nn1C |
| InChI | InChI=1S/C32H38F2N6O4/c1-19-22(29(37-38(19)5)31(43)32(2,3)4)12-15-44-30-23(7-8-24(33)28(30)34)20-6-9-25-36-17-21(40(25)18-20)16-35-13-14-39-26(41)10-11-27(39)42/h6-9,17-18,31,35,43H,10-16H2,1-5H3 |
| InChIKey | YJYAXMLQDRRCGY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|