C22H41NO4 — CID 178169046
tert-butyl 2,2-dimethyl-7-(4-methyl-2-propylpentyl)-4a,6,7,7a-tetrahydro-4H-[1,3]dioxino[5,4-b]pyrrole-5-carboxylate (PubChem CID 178169046) has the molecular formula C22H41NO4 and a molecular weight of 383.57 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-7-(4-methyl-2-propylpentyl)-4a,6,7,7a-tetrahydro-4H-[1,3]dioxino[5,4-b]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2,2-dimethyl-7-(4-methyl-2-propylpentyl)-4a,6,7,7a-tetrahydro-4H-[1,3]dioxino[5,4-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 178169046 |
| Molecular Formula | C22H41NO4 |
| Molecular Weight | 383.57 g/mol |
| Exact Mass | 383.30 |
| IUPAC Name | tert-butyl 2,2-dimethyl-7-(4-methyl-2-propylpentyl)-4a,6,7,7a-tetrahydro-4H-[1,3]dioxino[5,4-b]pyrrole-5-carboxylate |
| SMILES | CCCC(CC(C)C)CC1CN(C(=O)OC(C)(C)C)C2COC(C)(C)OC12 |
| InChI | InChI=1S/C22H41NO4/c1-9-10-16(11-15(2)3)12-17-13-23(20(24)27-21(4,5)6)18-14-25-22(7,8)26-19(17)18/h15-19H,9-14H2,1-8H3 |
| InChIKey | UZSOUSYWLCYLJQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |