C13H25NO2 — CID 178169055
[4-(2-methylpropyl)-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrol-8-yl]methanol (PubChem CID 178169055) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is [4-(2-methylpropyl)-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrol-8-yl]methanol.
| Compound Name | [4-(2-methylpropyl)-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrol-8-yl]methanol |
|---|---|
| PubChem CID | 178169055 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | [4-(2-methylpropyl)-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrol-8-yl]methanol |
| SMILES | CC(C)CC1CCOC2C(CNC2CO)C1 |
| InChI | InChI=1S/C13H25NO2/c1-9(2)5-10-3-4-16-13-11(6-10)7-14-12(13)8-15/h9-15H,3-8H2,1-2H3 |
| InChIKey | PXGAABQHYHMPGU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |