C22H39ClN2O5S — CID 174087294
(4R,5aS,8S,8aR)-N-[(1S,2S)-2-chloro-1-[(2S,4R)-4,5-dihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(2-methylpropyl)-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide (PubChem CID 174087294) has the molecular formula C22H39ClN2O5S and a molecular weight of 479.08 g/mol. Its IUPAC name is (4R,5aS,8S,8aR)-N-[(1S,2S)-2-chloro-1-[(2S,4R)-4,5-dihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(2-methylpropyl)-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide.
| Compound Name | (4R,5aS,8S,8aR)-N-[(1S,2S)-2-chloro-1-[(2S,4R)-4,5-dihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(2-methylpropyl)-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
|---|---|
| PubChem CID | 174087294 |
| Molecular Formula | C22H39ClN2O5S |
| Molecular Weight | 479.08 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | (4R,5aS,8S,8aR)-N-[(1S,2S)-2-chloro-1-[(2S,4R)-4,5-dihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(2-methylpropyl)-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
| SMILES | CSC1O[C@H]([C@H](NC(=O)[C@H]2NC[C@@H]3C[C@@H](CC(C)C)CCO[C@H]32)[C@H](C)Cl)C[C@@H](O)C1O |
| InChI | InChI=1S/C22H39ClN2O5S/c1-11(2)7-13-5-6-29-20-14(8-13)10-24-18(20)21(28)25-17(12(3)23)16-9-15(26)19(27)22(30-16)31-4/h11-20,22,24,26-27H,5-10H2,1-4H3,(H,25,28)/t12-,13+,14-,15+,16-,17+,18-,19?,20+,22?/m0/s1 |
| InChIKey | XBJBDYWVHNNXET-NZSFUUOYSA-N |
| XLogP | 1.73 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.08 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|