C18H31ClN2O8S — CID 137487155
N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-3,4-dihydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide (PubChem CID 137487155) has the molecular formula C18H31ClN2O8S and a molecular weight of 470.97 g/mol. Its IUPAC name is N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-3,4-dihydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide.
| Compound Name | N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-3,4-dihydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
|---|---|
| PubChem CID | 137487155 |
| Molecular Formula | C18H31ClN2O8S |
| Molecular Weight | 470.97 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-3,4-dihydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
| SMILES | CSC1OC(C(NC(=O)C2NCC3CC(O)C(O)COC32)C(C)Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C18H31ClN2O8S/c1-6(19)10(16-13(25)12(24)14(26)18(29-16)30-2)21-17(27)11-15-7(4-20-11)3-8(22)9(23)5-28-15/h6-16,18,20,22-26H,3-5H2,1-2H3,(H,21,27) |
| InChIKey | QZISBVLQDMAENS-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 160.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.97 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|