C17H27ClN2O6S — CID 137487102
(4aS,7S,7aR)-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-2,4a,5,6,7,7a-hexahydropyrano[2,3-c]pyrrole-7-carboxamide (PubChem CID 137487102) has the molecular formula C17H27ClN2O6S and a molecular weight of 422.93 g/mol. Its IUPAC name is (4aS,7S,7aR)-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-2,4a,5,6,7,7a-hexahydropyrano[2,3-c]pyrrole-7-carboxamide.
| Compound Name | (4aS,7S,7aR)-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-2,4a,5,6,7,7a-hexahydropyrano[2,3-c]pyrrole-7-carboxamide |
|---|---|
| PubChem CID | 137487102 |
| Molecular Formula | C17H27ClN2O6S |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (4aS,7S,7aR)-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-2,4a,5,6,7,7a-hexahydropyrano[2,3-c]pyrrole-7-carboxamide |
| SMILES | CSC1OC([C@H](NC(=O)[C@H]2NC[C@@H]3C=CCO[C@@H]23)[C@H](C)Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C17H27ClN2O6S/c1-7(18)9(15-12(22)11(21)13(23)17(26-15)27-2)20-16(24)10-14-8(6-19-10)4-3-5-25-14/h3-4,7-15,17,19,21-23H,5-6H2,1-2H3,(H,20,24)/t7-,8-,9+,10-,11?,12?,13?,14+,15?,17?/m0/s1 |
| InChIKey | ORJXHWPBWYSUGA-AKTPJASUSA-N |
| XLogP | -1.19 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|