C18H32ClN3O6S — CID 137487293
N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-methyl-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine-8-carboxamide (PubChem CID 137487293) has the molecular formula C18H32ClN3O6S and a molecular weight of 453.99 g/mol. Its IUPAC name is N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-methyl-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine-8-carboxamide.
| Compound Name | N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-methyl-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine-8-carboxamide |
|---|---|
| PubChem CID | 137487293 |
| Molecular Formula | C18H32ClN3O6S |
| Molecular Weight | 453.99 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-methyl-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine-8-carboxamide |
| SMILES | CSC1OC(C(NC(=O)C2NCC3CN(C)CCOC32)C(C)Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C18H32ClN3O6S/c1-8(19)10(16-13(24)12(23)14(25)18(28-16)29-3)21-17(26)11-15-9(6-20-11)7-22(2)4-5-27-15/h8-16,18,20,23-25H,4-7H2,1-3H3,(H,21,26) |
| InChIKey | LZHAXQUTVJUZQR-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.99 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|