C19H32ClN3O8S — CID 142528592
2-[(5aR,8S,8aR)-8-[[(1S,2S)-2-chloro-1-[(2R,5R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]carbamoyl]-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepin-4-yl]acetic acid (PubChem CID 142528592) has the molecular formula C19H32ClN3O8S and a molecular weight of 498.00 g/mol. Its IUPAC name is 2-[(5aR,8S,8aR)-8-[[(1S,2S)-2-chloro-1-[(2R,5R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]carbamoyl]-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepin-4-yl]acetic acid.
| Compound Name | 2-[(5aR,8S,8aR)-8-[[(1S,2S)-2-chloro-1-[(2R,5R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]carbamoyl]-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepin-4-yl]acetic acid |
|---|---|
| PubChem CID | 142528592 |
| Molecular Formula | C19H32ClN3O8S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 2-[(5aR,8S,8aR)-8-[[(1S,2S)-2-chloro-1-[(2R,5R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]carbamoyl]-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepin-4-yl]acetic acid |
| SMILES | CSC1O[C@H]([C@H](NC(=O)[C@H]2NC[C@@H]3CN(CC(=O)O)CCO[C@H]32)[C@H](C)Cl)C(O)C(O)[C@H]1O |
| InChI | InChI=1S/C19H32ClN3O8S/c1-8(20)11(17-14(27)13(26)15(28)19(31-17)32-2)22-18(29)12-16-9(5-21-12)6-23(3-4-30-16)7-10(24)25/h8-9,11-17,19,21,26-28H,3-7H2,1-2H3,(H,22,29)(H,24,25)/t8-,9+,11+,12-,13?,14?,15+,16+,17+,19?/m0/s1 |
| InChIKey | SNEPMIRRXWNXOR-ONPKZGTFSA-N |
| XLogP | -2.36 |
| TPSA | 160.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|